C10H13NO2S — CID 175764526
1,3,5-trimethyl-2-(sulfinoiminomethyl)benzene (PubChem CID 175764526) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-(sulfinoiminomethyl)benzene.
| Compound Name | 1,3,5-trimethyl-2-(sulfinoiminomethyl)benzene |
|---|---|
| PubChem CID | 175764526 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 1,3,5-trimethyl-2-(sulfinoiminomethyl)benzene |
| SMILES | Cc1cc(C)c(C=NS(=O)O)c(C)c1 |
| InChI | InChI=1S/C10H13NO2S/c1-7-4-8(2)10(9(3)5-7)6-11-14(12)13/h4-6H,1-3H3,(H,12,13) |
| InChIKey | DPVZKVPYKBHUKI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|