C28H28 — CID 20723698
1,3,4,6,7,9,10,12-octamethylperylene (PubChem CID 20723698) has the molecular formula C28H28 and a molecular weight of 364.53 g/mol. Its IUPAC name is 1,3,4,6,7,9,10,12-octamethylperylene.
| Compound Name | 1,3,4,6,7,9,10,12-octamethylperylene |
|---|---|
| PubChem CID | 20723698 |
| Molecular Formula | C28H28 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1,3,4,6,7,9,10,12-octamethylperylene |
| SMILES | Cc1cc(C)c2c3c(C)cc(C)c4c(C)cc(C)c(c5c(C)cc(C)c1c25)c43 |
| InChI | InChI=1S/C28H28/c1-13-9-17(5)23-25-19(7)11-15(3)22-16(4)12-20(8)26(28(22)25)24-18(6)10-14(2)21(13)27(23)24/h9-12H,1-8H3 |
| InChIKey | LNIHKKRMGDZBPJ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|