C8H13NO — CID 154104183
1,2,4,5-tetramethylpyrrol-3-ol (PubChem CID 154104183) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 1,2,4,5-tetramethylpyrrol-3-ol.
| Compound Name | 1,2,4,5-tetramethylpyrrol-3-ol |
|---|---|
| PubChem CID | 154104183 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 1,2,4,5-tetramethylpyrrol-3-ol |
| SMILES | Cc1c(O)c(C)n(C)c1C |
| InChI | InChI=1S/C8H13NO/c1-5-6(2)9(4)7(3)8(5)10/h10H,1-4H3 |
| InChIKey | GLDAJXOTBRHOLK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |