C21H33N — CID 160751082
1,2,3,4,5,6-hexamethylbenzene;1,2,3,4,5-pentamethylpyrrole (PubChem CID 160751082) has the molecular formula C21H33N and a molecular weight of 299.50 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexamethylbenzene;1,2,3,4,5-pentamethylpyrrole.
| Compound Name | 1,2,3,4,5,6-hexamethylbenzene;1,2,3,4,5-pentamethylpyrrole |
|---|---|
| PubChem CID | 160751082 |
| Molecular Formula | C21H33N |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | 1,2,3,4,5,6-hexamethylbenzene;1,2,3,4,5-pentamethylpyrrole |
| SMILES | Cc1c(C)c(C)c(C)c(C)c1C.Cc1c(C)c(C)n(C)c1C |
| InChI | InChI=1S/C12H18.C9H15N/c1-7-8(2)10(4)12(6)11(5)9(7)3;1-6-7(2)9(4)10(5)8(6)3/h1-6H3;1-5H3 |
| InChIKey | RWVDKURQGHGFBZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |