C10H12N2O2 — CID 23382241
3-isocyanato-1,4,5,6-tetramethylpyridin-2-one (PubChem CID 23382241) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 3-isocyanato-1,4,5,6-tetramethylpyridin-2-one.
| Compound Name | 3-isocyanato-1,4,5,6-tetramethylpyridin-2-one |
|---|---|
| PubChem CID | 23382241 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 3-isocyanato-1,4,5,6-tetramethylpyridin-2-one |
| SMILES | Cc1c(C)c(C)n(C)c(=O)c1N=C=O |
| InChI | InChI=1S/C10H12N2O2/c1-6-7(2)9(11-5-13)10(14)12(4)8(6)3/h1-4H3 |
| InChIKey | HIGJFDQOQWAOBA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|