C10H11ClN2 — CID 141136063
5-chloro-1,2,3-trimethylpyrrolo[2,3-c]pyridine (PubChem CID 141136063) has the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. Its IUPAC name is 5-chloro-1,2,3-trimethylpyrrolo[2,3-c]pyridine.
| Compound Name | 5-chloro-1,2,3-trimethylpyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 141136063 |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 5-chloro-1,2,3-trimethylpyrrolo[2,3-c]pyridine |
| SMILES | Cc1c(C)n(C)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C10H11ClN2/c1-6-7(2)13(3)9-5-12-10(11)4-8(6)9/h4-5H,1-3H3 |
| InChIKey | CBSHQZLPYBAPRE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|