C13H11ClN2 — CID 115038034
3-chloro-7,9-dimethylpyrido[3,4-b]indole (PubChem CID 115038034) has the molecular formula C13H11ClN2 and a molecular weight of 230.70 g/mol. Its IUPAC name is 3-chloro-7,9-dimethylpyrido[3,4-b]indole.
| Compound Name | 3-chloro-7,9-dimethylpyrido[3,4-b]indole |
|---|---|
| PubChem CID | 115038034 |
| Molecular Formula | C13H11ClN2 |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 3-chloro-7,9-dimethylpyrido[3,4-b]indole |
| SMILES | Cc1ccc2c3cc(Cl)ncc3n(C)c2c1 |
| InChI | InChI=1S/C13H11ClN2/c1-8-3-4-9-10-6-13(14)15-7-12(10)16(2)11(9)5-8/h3-7H,1-2H3 |
| InChIKey | HTJWUZQFUQPLHH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|