C12H11N3O — CID 162683751
5,7-dimethyl-3H-pyridazino[4,5-b]indol-4-one (PubChem CID 162683751) has the molecular formula C12H11N3O and a molecular weight of 213.24 g/mol. Its IUPAC name is 5,7-dimethyl-3H-pyridazino[4,5-b]indol-4-one.
| Compound Name | 5,7-dimethyl-3H-pyridazino[4,5-b]indol-4-one |
|---|---|
| PubChem CID | 162683751 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 5,7-dimethyl-3H-pyridazino[4,5-b]indol-4-one |
| SMILES | Cc1ccc2c3cn[nH]c(=O)c3n(C)c2c1 |
| InChI | InChI=1S/C12H11N3O/c1-7-3-4-8-9-6-13-14-12(16)11(9)15(2)10(8)5-7/h3-6H,1-2H3,(H,14,16) |
| InChIKey | WCLQBAHXCAVPJP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |