C19H24N4O — CID 71626462
16-[2-(dimethylamino)ethyl]-3,3-dimethyl-6,7,16-triazatetracyclo[11.2.1.05,15.09,14]hexadeca-1(15),5,9(14),10,12-pentaen-8-one (PubChem CID 71626462) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is 16-[2-(dimethylamino)ethyl]-3,3-dimethyl-6,7,16-triazatetracyclo[11.2.1.05,15.09,14]hexadeca-1(15),5,9(14),10,12-pentaen-8-one.
| Compound Name | 16-[2-(dimethylamino)ethyl]-3,3-dimethyl-6,7,16-triazatetracyclo[11.2.1.05,15.09,14]hexadeca-1(15),5,9(14),10,12-pentaen-8-one |
|---|---|
| PubChem CID | 71626462 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 16-[2-(dimethylamino)ethyl]-3,3-dimethyl-6,7,16-triazatetracyclo[11.2.1.05,15.09,14]hexadeca-1(15),5,9(14),10,12-pentaen-8-one |
| SMILES | CN(C)CCn1c2c3c4c(cccc41)C(=O)NN=C3CC(C)(C)C2 |
| InChI | InChI=1S/C19H24N4O/c1-19(2)10-13-17-15(11-19)23(9-8-22(3)4)14-7-5-6-12(16(14)17)18(24)21-20-13/h5-7H,8-11H2,1-4H3,(H,21,24) |
| InChIKey | XPCCVBMKWOBTFC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |