C13H19NSi — CID 177474758
(1,6-dimethylindol-3-yl)-trimethylsilane (PubChem CID 177474758) has the molecular formula C13H19NSi and a molecular weight of 217.39 g/mol. Its IUPAC name is (1,6-dimethylindol-3-yl)-trimethylsilane.
| Compound Name | (1,6-dimethylindol-3-yl)-trimethylsilane |
|---|---|
| PubChem CID | 177474758 |
| Molecular Formula | C13H19NSi |
| Molecular Weight | 217.39 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (1,6-dimethylindol-3-yl)-trimethylsilane |
| SMILES | Cc1ccc2c([Si](C)(C)C)cn(C)c2c1 |
| InChI | InChI=1S/C13H19NSi/c1-10-6-7-11-12(8-10)14(2)9-13(11)15(3,4)5/h6-9H,1-5H3 |
| InChIKey | BDWCKPXFDYDLAD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|