C16H15NO2 — CID 116546982
(1,6-dimethylindol-3-yl)-(2-methylfuran-3-yl)methanone (PubChem CID 116546982) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is (1,6-dimethylindol-3-yl)-(2-methylfuran-3-yl)methanone.
| Compound Name | (1,6-dimethylindol-3-yl)-(2-methylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 116546982 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (1,6-dimethylindol-3-yl)-(2-methylfuran-3-yl)methanone |
| SMILES | Cc1ccc2c(C(=O)c3ccoc3C)cn(C)c2c1 |
| InChI | InChI=1S/C16H15NO2/c1-10-4-5-13-14(9-17(3)15(13)8-10)16(18)12-6-7-19-11(12)2/h4-9H,1-3H3 |
| InChIKey | IKUACGKMKKNCFO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |