C13H11ClN2O — CID 115045950
3-chloro-5-methoxy-9-methylpyrido[3,4-b]indole (PubChem CID 115045950) has the molecular formula C13H11ClN2O and a molecular weight of 246.70 g/mol. Its IUPAC name is 3-chloro-5-methoxy-9-methylpyrido[3,4-b]indole.
| Compound Name | 3-chloro-5-methoxy-9-methylpyrido[3,4-b]indole |
|---|---|
| PubChem CID | 115045950 |
| Molecular Formula | C13H11ClN2O |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 3-chloro-5-methoxy-9-methylpyrido[3,4-b]indole |
| SMILES | COc1cccc2c1c1cc(Cl)ncc1n2C |
| InChI | InChI=1S/C13H11ClN2O/c1-16-9-4-3-5-11(17-2)13(9)8-6-12(14)15-7-10(8)16/h3-7H,1-2H3 |
| InChIKey | WLKOKYCJYNKLRZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|