C15H11F2NO2 — CID 102061435
6,7-difluoro-1-methoxy-10-methylacridin-9-one (PubChem CID 102061435) has the molecular formula C15H11F2NO2 and a molecular weight of 275.25 g/mol. Its IUPAC name is 6,7-difluoro-1-methoxy-10-methylacridin-9-one.
| Compound Name | 6,7-difluoro-1-methoxy-10-methylacridin-9-one |
|---|---|
| PubChem CID | 102061435 |
| Molecular Formula | C15H11F2NO2 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 6,7-difluoro-1-methoxy-10-methylacridin-9-one |
| SMILES | COc1cccc2c1c(=O)c1cc(F)c(F)cc1n2C |
| InChI | InChI=1S/C15H11F2NO2/c1-18-11-4-3-5-13(20-2)14(11)15(19)8-6-9(16)10(17)7-12(8)18/h3-7H,1-2H3 |
| InChIKey | WSJGGDZXLZQDLC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|