C13H12N2O2 — CID 115036593
5-methoxy-9-methyl-2H-pyrido[3,4-b]indol-1-one (PubChem CID 115036593) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 5-methoxy-9-methyl-2H-pyrido[3,4-b]indol-1-one.
| Compound Name | 5-methoxy-9-methyl-2H-pyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 115036593 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 5-methoxy-9-methyl-2H-pyrido[3,4-b]indol-1-one |
| SMILES | COc1cccc2c1c1cc[nH]c(=O)c1n2C |
| InChI | InChI=1S/C13H12N2O2/c1-15-9-4-3-5-10(17-2)11(9)8-6-7-14-13(16)12(8)15/h3-7H,1-2H3,(H,14,16) |
| InChIKey | NDSILBQQXWBUGQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |