C11H13N3O3 — CID 117262276
3-(aminomethyl)-5-methoxy-1-methylquinazoline-2,4-dione (PubChem CID 117262276) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 3-(aminomethyl)-5-methoxy-1-methylquinazoline-2,4-dione.
| Compound Name | 3-(aminomethyl)-5-methoxy-1-methylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 117262276 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-(aminomethyl)-5-methoxy-1-methylquinazoline-2,4-dione |
| SMILES | COc1cccc2c1c(=O)n(CN)c(=O)n2C |
| InChI | InChI=1S/C11H13N3O3/c1-13-7-4-3-5-8(17-2)9(7)10(15)14(6-12)11(13)16/h3-5H,6,12H2,1-2H3 |
| InChIKey | LMJZSNUNOOWXCX-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |