C11H11FN2O3 — CID 117262049
5-fluoro-3-(2-hydroxyethyl)-1-methylquinazoline-2,4-dione (PubChem CID 117262049) has the molecular formula C11H11FN2O3 and a molecular weight of 238.22 g/mol. Its IUPAC name is 5-fluoro-3-(2-hydroxyethyl)-1-methylquinazoline-2,4-dione.
| Compound Name | 5-fluoro-3-(2-hydroxyethyl)-1-methylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 117262049 |
| Molecular Formula | C11H11FN2O3 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 5-fluoro-3-(2-hydroxyethyl)-1-methylquinazoline-2,4-dione |
| SMILES | Cn1c(=O)n(CCO)c(=O)c2c(F)cccc21 |
| InChI | InChI=1S/C11H11FN2O3/c1-13-8-4-2-3-7(12)9(8)10(16)14(5-6-15)11(13)17/h2-4,15H,5-6H2,1H3 |
| InChIKey | CQHSVKAVPVYZRL-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |