C13H12N2O — CID 115027878
8,9-dimethyl-2H-pyrido[3,4-b]indol-1-one (PubChem CID 115027878) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is 8,9-dimethyl-2H-pyrido[3,4-b]indol-1-one.
| Compound Name | 8,9-dimethyl-2H-pyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 115027878 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 8,9-dimethyl-2H-pyrido[3,4-b]indol-1-one |
| SMILES | Cc1cccc2c3cc[nH]c(=O)c3n(C)c12 |
| InChI | InChI=1S/C13H12N2O/c1-8-4-3-5-9-10-6-7-14-13(16)12(10)15(2)11(8)9/h3-7H,1-2H3,(H,14,16) |
| InChIKey | LVTGNRCXUQGUKL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |