C23H19NO — CID 166440034
1,8-dimethyl-2,3-diphenylquinolin-4-one (PubChem CID 166440034) has the molecular formula C23H19NO and a molecular weight of 325.41 g/mol. Its IUPAC name is 1,8-dimethyl-2,3-diphenylquinolin-4-one.
| Compound Name | 1,8-dimethyl-2,3-diphenylquinolin-4-one |
|---|---|
| PubChem CID | 166440034 |
| Molecular Formula | C23H19NO |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1,8-dimethyl-2,3-diphenylquinolin-4-one |
| SMILES | Cc1cccc2c(=O)c(-c3ccccc3)c(-c3ccccc3)n(C)c12 |
| InChI | InChI=1S/C23H19NO/c1-16-10-9-15-19-21(16)24(2)22(18-13-7-4-8-14-18)20(23(19)25)17-11-5-3-6-12-17/h3-15H,1-2H3 |
| InChIKey | WXBYYZQNNOLNJU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |