C26H25NO — CID 166440021
6-tert-butyl-1-methyl-2,3-diphenylquinolin-4-one (PubChem CID 166440021) has the molecular formula C26H25NO and a molecular weight of 367.49 g/mol. Its IUPAC name is 6-tert-butyl-1-methyl-2,3-diphenylquinolin-4-one.
| Compound Name | 6-tert-butyl-1-methyl-2,3-diphenylquinolin-4-one |
|---|---|
| PubChem CID | 166440021 |
| Molecular Formula | C26H25NO |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 6-tert-butyl-1-methyl-2,3-diphenylquinolin-4-one |
| SMILES | Cn1c(-c2ccccc2)c(-c2ccccc2)c(=O)c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C26H25NO/c1-26(2,3)20-15-16-22-21(17-20)25(28)23(18-11-7-5-8-12-18)24(27(22)4)19-13-9-6-10-14-19/h5-17H,1-4H3 |
| InChIKey | MMTRUZPINSFUMO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |