C39H31NO — CID 102307137
11-tert-butyl-5,6,13-triphenylisoquinolino[2,1-b]isoquinolin-8-one (PubChem CID 102307137) has the molecular formula C39H31NO and a molecular weight of 529.68 g/mol. Its IUPAC name is 11-tert-butyl-5,6,13-triphenylisoquinolino[2,1-b]isoquinolin-8-one.
| Compound Name | 11-tert-butyl-5,6,13-triphenylisoquinolino[2,1-b]isoquinolin-8-one |
|---|---|
| PubChem CID | 102307137 |
| Molecular Formula | C39H31NO |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 11-tert-butyl-5,6,13-triphenylisoquinolino[2,1-b]isoquinolin-8-one |
| SMILES | CC(C)(C)c1ccc2c(=O)n3c(-c4ccccc4)c(-c4ccccc4)c4ccccc4c3c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C39H31NO/c1-39(2,3)29-23-24-32-33(25-29)35(27-17-9-5-10-18-27)37-31-22-14-13-21-30(31)34(26-15-7-4-8-16-26)36(40(37)38(32)41)28-19-11-6-12-20-28/h4-25H,1-3H3 |
| InChIKey | ZKMNRTNLDMVMGB-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 21.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|