C50H32N4O — CID 164913433
11-(4,6-diphenyl-1,3,5-triazin-2-yl)-5,6,13-triphenylisoquinolino[2,1-b]isoquinolin-8-one (PubChem CID 164913433) has the molecular formula C50H32N4O and a molecular weight of 704.83 g/mol. Its IUPAC name is 11-(4,6-diphenyl-1,3,5-triazin-2-yl)-5,6,13-triphenylisoquinolino[2,1-b]isoquinolin-8-one.
| Compound Name | 11-(4,6-diphenyl-1,3,5-triazin-2-yl)-5,6,13-triphenylisoquinolino[2,1-b]isoquinolin-8-one |
|---|---|
| PubChem CID | 164913433 |
| Molecular Formula | C50H32N4O |
| Molecular Weight | 704.83 g/mol |
| Exact Mass | 704.26 |
| IUPAC Name | 11-(4,6-diphenyl-1,3,5-triazin-2-yl)-5,6,13-triphenylisoquinolino[2,1-b]isoquinolin-8-one |
| SMILES | O=c1c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2c(-c2ccccc2)c2c3ccccc3c(-c3ccccc3)c(-c3ccccc3)n12 |
| InChI | InChI=1S/C50H32N4O/c55-50-41-31-30-38(49-52-47(36-24-12-4-13-25-36)51-48(53-49)37-26-14-5-15-27-37)32-42(41)44(34-20-8-2-9-21-34)46-40-29-17-16-28-39(40)43(33-18-6-1-7-19-33)45(54(46)50)35-22-10-3-11-23-35/h1-32H |
| InChIKey | PATVBHOXJQMSBO-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.83 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|