C26H24O — CID 138969967
6-tert-butyl-3,4-diphenylnaphthalen-1-ol (PubChem CID 138969967) has the molecular formula C26H24O and a molecular weight of 352.48 g/mol. Its IUPAC name is 6-tert-butyl-3,4-diphenylnaphthalen-1-ol.
| Compound Name | 6-tert-butyl-3,4-diphenylnaphthalen-1-ol |
|---|---|
| PubChem CID | 138969967 |
| Molecular Formula | C26H24O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 6-tert-butyl-3,4-diphenylnaphthalen-1-ol |
| SMILES | CC(C)(C)c1ccc2c(O)cc(-c3ccccc3)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C26H24O/c1-26(2,3)20-14-15-21-23(16-20)25(19-12-8-5-9-13-19)22(17-24(21)27)18-10-6-4-7-11-18/h4-17,27H,1-3H3 |
| InChIKey | WFCUEOGSNKWTHO-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |