C35H33NSi — CID 174101281
(6-tert-butyl-9-methylcarbazol-3-yl)-triphenylsilane (PubChem CID 174101281) has the molecular formula C35H33NSi and a molecular weight of 495.74 g/mol. Its IUPAC name is (6-tert-butyl-9-methylcarbazol-3-yl)-triphenylsilane.
| Compound Name | (6-tert-butyl-9-methylcarbazol-3-yl)-triphenylsilane |
|---|---|
| PubChem CID | 174101281 |
| Molecular Formula | C35H33NSi |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | (6-tert-butyl-9-methylcarbazol-3-yl)-triphenylsilane |
| SMILES | Cn1c2ccc(C(C)(C)C)cc2c2cc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C35H33NSi/c1-35(2,3)26-20-22-33-31(24-26)32-25-30(21-23-34(32)36(33)4)37(27-14-8-5-9-15-27,28-16-10-6-11-17-28)29-18-12-7-13-19-29/h5-25H,1-4H3 |
| InChIKey | ZQIJZYIFINENIK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|