C77H65N5Si2 — CID 162485372
[3-[4-carbazol-9-yl-6-(3,6-ditert-butylcarbazol-9-yl)-1,3,5-triazin-2-yl]-5-triphenylsilylphenyl]-triphenylsilane (PubChem CID 162485372) has the molecular formula C77H65N5Si2 and a molecular weight of 1116.57 g/mol. Its IUPAC name is [3-[4-carbazol-9-yl-6-(3,6-ditert-butylcarbazol-9-yl)-1,3,5-triazin-2-yl]-5-triphenylsilylphenyl]-triphenylsilane.
| Compound Name | [3-[4-carbazol-9-yl-6-(3,6-ditert-butylcarbazol-9-yl)-1,3,5-triazin-2-yl]-5-triphenylsilylphenyl]-triphenylsilane |
|---|---|
| PubChem CID | 162485372 |
| Molecular Formula | C77H65N5Si2 |
| Molecular Weight | 1116.57 g/mol |
| Exact Mass | 1115.48 |
| IUPAC Name | [3-[4-carbazol-9-yl-6-(3,6-ditert-butylcarbazol-9-yl)-1,3,5-triazin-2-yl]-5-triphenylsilylphenyl]-triphenylsilane |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1nc(-c2cc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)cc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c2)nc(-n2c3ccccc3c3ccccc32)n1 |
| InChI | InChI=1S/C77H65N5Si2/c1-76(2,3)55-45-47-71-67(51-55)68-52-56(77(4,5)6)46-48-72(68)82(71)75-79-73(78-74(80-75)81-69-43-27-25-41-65(69)66-42-26-28-44-70(66)81)54-49-63(83(57-29-13-7-14-30-57,58-31-15-8-16-32-58)59-33-17-9-18-34-59)53-64(50-54)84(60-35-19-10-20-36-60,61-37-21-11-22-38-61)62-39-23-12-24-40-62/h7-53H,1-6H3 |
| InChIKey | HDAZIYDNVCMHBP-UHFFFAOYSA-N |
| XLogP | 13.08 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1116.57 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|