C41H37N5 — CID 170669493
3-tert-butyl-9-[4-(3-tert-butylphenyl)-6-carbazol-9-yl-1,3,5-triazin-2-yl]carbazole (PubChem CID 170669493) has the molecular formula C41H37N5 and a molecular weight of 599.78 g/mol. Its IUPAC name is 3-tert-butyl-9-[4-(3-tert-butylphenyl)-6-carbazol-9-yl-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 3-tert-butyl-9-[4-(3-tert-butylphenyl)-6-carbazol-9-yl-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 170669493 |
| Molecular Formula | C41H37N5 |
| Molecular Weight | 599.78 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | 3-tert-butyl-9-[4-(3-tert-butylphenyl)-6-carbazol-9-yl-1,3,5-triazin-2-yl]carbazole |
| SMILES | CC(C)(C)c1cccc(-c2nc(-n3c4ccccc4c4ccccc43)nc(-n3c4ccccc4c4cc(C(C)(C)C)ccc43)n2)c1 |
| InChI | InChI=1S/C41H37N5/c1-40(2,3)27-15-13-14-26(24-27)37-42-38(45-33-19-10-7-16-29(33)30-17-8-11-20-34(30)45)44-39(43-37)46-35-21-12-9-18-31(35)32-25-28(41(4,5)6)22-23-36(32)46/h7-25H,1-6H3 |
| InChIKey | XAOYRYDXMNQNOZ-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.78 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |