C75H58N8 — CID 153461388
3,6-ditert-butyl-9-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-bis(3-phenylcarbazol-9-yl)pyrimidin-2-yl]carbazole (PubChem CID 153461388) has the molecular formula C75H58N8 and a molecular weight of 1071.35 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-bis(3-phenylcarbazol-9-yl)pyrimidin-2-yl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-bis(3-phenylcarbazol-9-yl)pyrimidin-2-yl]carbazole |
|---|---|
| PubChem CID | 153461388 |
| Molecular Formula | C75H58N8 |
| Molecular Weight | 1071.35 g/mol |
| Exact Mass | 1070.48 |
| IUPAC Name | 3,6-ditert-butyl-9-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-bis(3-phenylcarbazol-9-yl)pyrimidin-2-yl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1nc(-n2c3ccccc3c3cc(-c4ccccc4)ccc32)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(-n2c3ccccc3c3cc(-c4ccccc4)ccc32)n1 |
| InChI | InChI=1S/C75H58N8/c1-74(2,3)53-37-41-65-59(45-53)60-46-54(75(4,5)6)38-42-66(60)83(65)73-79-71(81-61-33-21-19-31-55(61)57-43-51(35-39-63(57)81)47-23-11-7-12-24-47)67(70-77-68(49-27-15-9-16-28-49)76-69(78-70)50-29-17-10-18-30-50)72(80-73)82-62-34-22-20-32-56(62)58-44-52(36-40-64(58)82)48-25-13-8-14-26-48/h7-46H,1-6H3 |
| InChIKey | RMTQOLQPKSIIJY-UHFFFAOYSA-N |
| XLogP | 18.88 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1071.35 |
| LogP ≤ 5 | 18.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |