C50H45NOSi — CID 58049752
[8-(3,6-ditert-butylcarbazol-9-yl)dibenzofuran-2-yl]-triphenylsilane (PubChem CID 58049752) has the molecular formula C50H45NOSi and a molecular weight of 704.00 g/mol. Its IUPAC name is [8-(3,6-ditert-butylcarbazol-9-yl)dibenzofuran-2-yl]-triphenylsilane.
| Compound Name | [8-(3,6-ditert-butylcarbazol-9-yl)dibenzofuran-2-yl]-triphenylsilane |
|---|---|
| PubChem CID | 58049752 |
| Molecular Formula | C50H45NOSi |
| Molecular Weight | 704.00 g/mol |
| Exact Mass | 703.33 |
| IUPAC Name | [8-(3,6-ditert-butylcarbazol-9-yl)dibenzofuran-2-yl]-triphenylsilane |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc2oc3ccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc3c2c1 |
| InChI | InChI=1S/C50H45NOSi/c1-49(2,3)34-22-26-45-41(30-34)42-31-35(50(4,5)6)23-27-46(42)51(45)36-24-28-47-43(32-36)44-33-40(25-29-48(44)52-47)53(37-16-10-7-11-17-37,38-18-12-8-13-19-38)39-20-14-9-15-21-39/h7-33H,1-6H3 |
| InChIKey | SCJSJLJQGMUWSR-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.00 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|