C36H28N2O4 — CID 138654549
4,11-bis(2-methoxyphenyl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione (PubChem CID 138654549) has the molecular formula C36H28N2O4 and a molecular weight of 552.63 g/mol. Its IUPAC name is 4,11-bis(2-methoxyphenyl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 4,11-bis(2-methoxyphenyl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 138654549 |
| Molecular Formula | C36H28N2O4 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 4,11-bis(2-methoxyphenyl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione |
| SMILES | COc1ccccc1-c1cccc2c(=O)c3cc4c(cc3n(C)c12)c(=O)c1cccc(-c2ccccc2OC)c1n4C |
| InChI | InChI=1S/C36H28N2O4/c1-37-29-19-28-30(38(2)34-24(14-10-16-26(34)36(28)40)22-12-6-8-18-32(22)42-4)20-27(29)35(39)25-15-9-13-23(33(25)37)21-11-5-7-17-31(21)41-3/h5-20H,1-4H3 |
| InChIKey | SLYXKVXVAGFAHN-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|