C30H26N2O2 — CID 145450912
2-but-1-en-2-yl-3-ethenyl-1,6-dimethyl-7-phenylpyrido[2,3-b]acridine-4,11-dione (PubChem CID 145450912) has the molecular formula C30H26N2O2 and a molecular weight of 446.55 g/mol. Its IUPAC name is 2-but-1-en-2-yl-3-ethenyl-1,6-dimethyl-7-phenylpyrido[2,3-b]acridine-4,11-dione.
| Compound Name | 2-but-1-en-2-yl-3-ethenyl-1,6-dimethyl-7-phenylpyrido[2,3-b]acridine-4,11-dione |
|---|---|
| PubChem CID | 145450912 |
| Molecular Formula | C30H26N2O2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 2-but-1-en-2-yl-3-ethenyl-1,6-dimethyl-7-phenylpyrido[2,3-b]acridine-4,11-dione |
| SMILES | C=Cc1c(C(=C)CC)n(C)c2cc3c(=O)c4cccc(-c5ccccc5)c4n(C)c3cc2c1=O |
| InChI | InChI=1S/C30H26N2O2/c1-6-18(3)27-20(7-2)29(33)23-16-26-24(17-25(23)31(27)4)30(34)22-15-11-14-21(28(22)32(26)5)19-12-9-8-10-13-19/h7-17H,2-3,6H2,1,4-5H3 |
| InChIKey | SRWRGOBULMTHSN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|