C37H38N2O2 — CID 145450897
3-ethenyl-1-ethyl-6-(N-ethyl-2-methyl-6-phenylanilino)-2-[(4Z,6Z)-octa-1,4,6-trien-2-yl]-4-oxoquinoline-7-carbaldehyde (PubChem CID 145450897) has the molecular formula C37H38N2O2 and a molecular weight of 542.72 g/mol. Its IUPAC name is 3-ethenyl-1-ethyl-6-(N-ethyl-2-methyl-6-phenylanilino)-2-[(4Z,6Z)-octa-1,4,6-trien-2-yl]-4-oxoquinoline-7-carbaldehyde.
| Compound Name | 3-ethenyl-1-ethyl-6-(N-ethyl-2-methyl-6-phenylanilino)-2-[(4Z,6Z)-octa-1,4,6-trien-2-yl]-4-oxoquinoline-7-carbaldehyde |
|---|---|
| PubChem CID | 145450897 |
| Molecular Formula | C37H38N2O2 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | 3-ethenyl-1-ethyl-6-(N-ethyl-2-methyl-6-phenylanilino)-2-[(4Z,6Z)-octa-1,4,6-trien-2-yl]-4-oxoquinoline-7-carbaldehyde |
| SMILES | C=Cc1c(C(=C)C/C=C\C=C/C)n(CC)c2cc(C=O)c(N(CC)c3c(C)cccc3-c3ccccc3)cc2c1=O |
| InChI | InChI=1S/C37H38N2O2/c1-7-11-12-14-18-26(5)35-30(8-2)37(41)32-24-33(29(25-40)23-34(32)39(35)10-4)38(9-3)36-27(6)19-17-22-31(36)28-20-15-13-16-21-28/h7-8,11-17,19-25H,2,5,9-10,18H2,1,3-4,6H3/b11-7-,14-12- |
| InChIKey | CTECEEBMVKJNEN-QUGLMBAUSA-N |
| XLogP | 9.15 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|