C36H30N2O2 — CID 163818727
5,12-diethyl-4,11-diphenyl-7a,11a-dihydroquinolino[2,3-b]acridine-7,14-dione (PubChem CID 163818727) has the molecular formula C36H30N2O2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 5,12-diethyl-4,11-diphenyl-7a,11a-dihydroquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 5,12-diethyl-4,11-diphenyl-7a,11a-dihydroquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 163818727 |
| Molecular Formula | C36H30N2O2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 5,12-diethyl-4,11-diphenyl-7a,11a-dihydroquinolino[2,3-b]acridine-7,14-dione |
| SMILES | CCN1c2cc3c(=O)c4cccc(-c5ccccc5)c4n(CC)c3cc2C(=O)C2C=CC=C(c3ccccc3)C21 |
| InChI | InChI=1S/C36H30N2O2/c1-3-37-31-21-30-32(22-29(31)35(39)27-19-11-17-25(33(27)37)23-13-7-5-8-14-23)38(4-2)34-26(24-15-9-6-10-16-24)18-12-20-28(34)36(30)40/h5-22,27,33H,3-4H2,1-2H3 |
| InChIKey | NTOUUAGLUQTEMD-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|