C24H17Cl3N2O2 — CID 139791344
1,2,4-trichloro-5,12-diethylquinolino[2,3-b]acridine-7,14-dione (PubChem CID 139791344) has the molecular formula C24H17Cl3N2O2 and a molecular weight of 471.77 g/mol. Its IUPAC name is 1,2,4-trichloro-5,12-diethylquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 1,2,4-trichloro-5,12-diethylquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 139791344 |
| Molecular Formula | C24H17Cl3N2O2 |
| Molecular Weight | 471.77 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 1,2,4-trichloro-5,12-diethylquinolino[2,3-b]acridine-7,14-dione |
| SMILES | CCn1c2ccccc2c(=O)c2cc3c(cc21)c(=O)c1c(Cl)c(Cl)cc(Cl)c1n3CC |
| InChI | InChI=1S/C24H17Cl3N2O2/c1-3-28-17-8-6-5-7-12(17)23(30)13-9-19-14(10-18(13)28)24(31)20-21(27)15(25)11-16(26)22(20)29(19)4-2/h5-11H,3-4H2,1-2H3 |
| InChIKey | TUFKMZCIVSHKRG-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.77 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|