C16H14ClNO3 — CID 102061426
6-chloro-1,4-dimethoxy-10-methylacridin-9-one (PubChem CID 102061426) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 6-chloro-1,4-dimethoxy-10-methylacridin-9-one.
| Compound Name | 6-chloro-1,4-dimethoxy-10-methylacridin-9-one |
|---|---|
| PubChem CID | 102061426 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 6-chloro-1,4-dimethoxy-10-methylacridin-9-one |
| SMILES | COc1ccc(OC)c2c1c(=O)c1ccc(Cl)cc1n2C |
| InChI | InChI=1S/C16H14ClNO3/c1-18-11-8-9(17)4-5-10(11)16(19)14-12(20-2)6-7-13(21-3)15(14)18/h4-8H,1-3H3 |
| InChIKey | QAPNOOMJBQHGGD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|