C18H16ClF3N4 — CID 174240668
6-chloro-N-[1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-1,2-dimethylpyrido[3,4-d]pyrimidin-4-imine (PubChem CID 174240668) has the molecular formula C18H16ClF3N4 and a molecular weight of 380.80 g/mol. Its IUPAC name is 6-chloro-N-[1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-1,2-dimethylpyrido[3,4-d]pyrimidin-4-imine.
| Compound Name | 6-chloro-N-[1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-1,2-dimethylpyrido[3,4-d]pyrimidin-4-imine |
|---|---|
| PubChem CID | 174240668 |
| Molecular Formula | C18H16ClF3N4 |
| Molecular Weight | 380.80 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 6-chloro-N-[1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-1,2-dimethylpyrido[3,4-d]pyrimidin-4-imine |
| SMILES | Cc1n/c(=N\C(C)c2cccc(C(F)F)c2F)c2cc(Cl)ncc2n1C |
| InChI | InChI=1S/C18H16ClF3N4/c1-9(11-5-4-6-12(16(11)20)17(21)22)24-18-13-7-15(19)23-8-14(13)26(3)10(2)25-18/h4-9,17H,1-3H3/b24-18- |
| InChIKey | CFLLGQLMBCMVPD-MOHJPFBDSA-N |
| XLogP | 4.67 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.80 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|