C19H17ClF3N5 — CID 166476753
11-chloro-N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]-2,5,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,9,11-tetraen-8-imine (PubChem CID 166476753) has the molecular formula C19H17ClF3N5 and a molecular weight of 407.83 g/mol. Its IUPAC name is 11-chloro-N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]-2,5,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,9,11-tetraen-8-imine.
| Compound Name | 11-chloro-N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]-2,5,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,9,11-tetraen-8-imine |
|---|---|
| PubChem CID | 166476753 |
| Molecular Formula | C19H17ClF3N5 |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 11-chloro-N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]-2,5,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,9,11-tetraen-8-imine |
| SMILES | Cc1c(C(C)/N=c2\nc3n(c4cnc(Cl)cc24)CCN3)cccc1C(F)(F)F |
| InChI | InChI=1S/C19H17ClF3N5/c1-10-12(4-3-5-14(10)19(21,22)23)11(2)26-17-13-8-16(20)25-9-15(13)28-7-6-24-18(28)27-17/h3-5,8-9,11H,6-7H2,1-2H3,(H,24,26,27) |
| InChIKey | NXLPMDOECSKQPK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|