About 5-bromo-6-chloro-1,2,3-trimethylindole
5-bromo-6-chloro-1,2,3-trimethylindole (PubChem CID 84713394) has the molecular formula C11H11BrClN
and a molecular weight of 272.57 g/mol. Its IUPAC name is 5-bromo-6-chloro-1,2,3-trimethylindole.
Molecular Properties
| Compound Name | 5-bromo-6-chloro-1,2,3-trimethylindole |
| PubChem CID | 84713394 |
| Molecular Formula | C11H11BrClN |
| Molecular Weight | 272.57 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 5-bromo-6-chloro-1,2,3-trimethylindole |
| SMILES | Cc1c(C)n(C)c2cc(Cl)c(Br)cc12 |
| InChI | InChI=1S/C11H11BrClN/c1-6-7(2)14(3)11-5-10(13)9(12)4-8(6)11/h4-5H,1-3H3 |
| InChIKey | XFKLCUAKOFFPNZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-6-chloro-1,2,3-trimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-chloro-1,2,3-trimethylindole?
The IUPAC name of 5-bromo-6-chloro-1,2,3-trimethylindole (CID 84713394) is 5-bromo-6-chloro-1,2,3-trimethylindole.
What is the SMILES notation for 5-bromo-6-chloro-1,2,3-trimethylindole?
The canonical SMILES for 5-bromo-6-chloro-1,2,3-trimethylindole is Cc1c(C)n(C)c2cc(Cl)c(Br)cc12.
What is the InChIKey of 5-bromo-6-chloro-1,2,3-trimethylindole?
The InChIKey is XFKLCUAKOFFPNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrClN/c1-6-7(2)14(3)11-5-10(13)9(12)4-8(6)11/h4-5H,1-3H3.
What are the key properties of 5-bromo-6-chloro-1,2,3-trimethylindole?
5-bromo-6-chloro-1,2,3-trimethylindole has a molecular weight of 272.57 g/mol, XLogP of 4.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-chloro-1,2,3-trimethylindole is sourced from PubChem (CID 84713394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).