C11H11BrClN — CID 84713394
5-bromo-6-chloro-1,2,3-trimethylindole (PubChem CID 84713394) has the molecular formula C11H11BrClN and a molecular weight of 272.57 g/mol. Its IUPAC name is 5-bromo-6-chloro-1,2,3-trimethylindole.
| Compound Name | 5-bromo-6-chloro-1,2,3-trimethylindole |
|---|---|
| PubChem CID | 84713394 |
| Molecular Formula | C11H11BrClN |
| Molecular Weight | 272.57 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 5-bromo-6-chloro-1,2,3-trimethylindole |
| SMILES | Cc1c(C)n(C)c2cc(Cl)c(Br)cc12 |
| InChI | InChI=1S/C11H11BrClN/c1-6-7(2)14(3)11-5-10(13)9(12)4-8(6)11/h4-5H,1-3H3 |
| InChIKey | XFKLCUAKOFFPNZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|