C12H6F6N2 — CID 141297507
3,4,6-trifluoro-5-(2,3,6-trifluorophenyl)benzene-1,2-diamine (PubChem CID 141297507) has the molecular formula C12H6F6N2 and a molecular weight of 292.18 g/mol. Its IUPAC name is 3,4,6-trifluoro-5-(2,3,6-trifluorophenyl)benzene-1,2-diamine.
| Compound Name | 3,4,6-trifluoro-5-(2,3,6-trifluorophenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 141297507 |
| Molecular Formula | C12H6F6N2 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 3,4,6-trifluoro-5-(2,3,6-trifluorophenyl)benzene-1,2-diamine |
| SMILES | Nc1c(N)c(F)c(-c2c(F)ccc(F)c2F)c(F)c1F |
| InChI | InChI=1S/C12H6F6N2/c13-3-1-2-4(14)7(15)5(3)6-8(16)10(18)12(20)11(19)9(6)17/h1-2H,19-20H2 |
| InChIKey | NQWWLYALLLPUEH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|