C6H4F2N2O — CID 90887779
2,3-difluoro-6-nitrosoaniline (PubChem CID 90887779) has the molecular formula C6H4F2N2O and a molecular weight of 158.11 g/mol. Its IUPAC name is 2,3-difluoro-6-nitrosoaniline.
| Compound Name | 2,3-difluoro-6-nitrosoaniline |
|---|---|
| PubChem CID | 90887779 |
| Molecular Formula | C6H4F2N2O |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | 2,3-difluoro-6-nitrosoaniline |
| SMILES | Nc1c(N=O)ccc(F)c1F |
| InChI | InChI=1S/C6H4F2N2O/c7-3-1-2-4(10-11)6(9)5(3)8/h1-2H,9H2 |
| InChIKey | ATGAIPCOADTFIF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|