C12H4F7N — CID 118991076
3,5-difluoro-4-(2,3,4,5,6-pentafluorophenyl)aniline (PubChem CID 118991076) has the molecular formula C12H4F7N and a molecular weight of 295.16 g/mol. Its IUPAC name is 3,5-difluoro-4-(2,3,4,5,6-pentafluorophenyl)aniline.
| Compound Name | 3,5-difluoro-4-(2,3,4,5,6-pentafluorophenyl)aniline |
|---|---|
| PubChem CID | 118991076 |
| Molecular Formula | C12H4F7N |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 3,5-difluoro-4-(2,3,4,5,6-pentafluorophenyl)aniline |
| SMILES | Nc1cc(F)c(-c2c(F)c(F)c(F)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C12H4F7N/c13-4-1-3(20)2-5(14)6(4)7-8(15)10(17)12(19)11(18)9(7)16/h1-2H,20H2 |
| InChIKey | JAEVQISUUUOABS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|