C14H4Cl6F6N2 — CID 141003786
4-(4-amino-2,3,5,6-tetrafluorophenyl)-2,3-difluoro-5,6-bis(trichloromethyl)aniline (PubChem CID 141003786) has the molecular formula C14H4Cl6F6N2 and a molecular weight of 526.91 g/mol. Its IUPAC name is 4-(4-amino-2,3,5,6-tetrafluorophenyl)-2,3-difluoro-5,6-bis(trichloromethyl)aniline.
| Compound Name | 4-(4-amino-2,3,5,6-tetrafluorophenyl)-2,3-difluoro-5,6-bis(trichloromethyl)aniline |
|---|---|
| PubChem CID | 141003786 |
| Molecular Formula | C14H4Cl6F6N2 |
| Molecular Weight | 526.91 g/mol |
| Exact Mass | 523.84 |
| IUPAC Name | 4-(4-amino-2,3,5,6-tetrafluorophenyl)-2,3-difluoro-5,6-bis(trichloromethyl)aniline |
| SMILES | Nc1c(F)c(F)c(-c2c(F)c(F)c(N)c(C(Cl)(Cl)Cl)c2C(Cl)(Cl)Cl)c(F)c1F |
| InChI | InChI=1S/C14H4Cl6F6N2/c15-13(16,17)3-1(2-6(22)9(25)12(28)10(26)7(2)23)5(21)8(24)11(27)4(3)14(18,19)20/h27-28H2 |
| InChIKey | PZPYBTFZNUSTEP-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.91 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|