C22Cl10F6N2O4 — CID 139812409
3,4-dichloro-1-[4-[4-(3,4-dichloro-2,5-dioxopyrrol-1-yl)-2,3,5-trifluoro-6-(trichloromethyl)phenyl]-2,3,6-trifluoro-5-(trichloromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 139812409) has the molecular formula C22Cl10F6N2O4 and a molecular weight of 824.77 g/mol. Its IUPAC name is 3,4-dichloro-1-[4-[4-(3,4-dichloro-2,5-dioxopyrrol-1-yl)-2,3,5-trifluoro-6-(trichloromethyl)phenyl]-2,3,6-trifluoro-5-(trichloromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 3,4-dichloro-1-[4-[4-(3,4-dichloro-2,5-dioxopyrrol-1-yl)-2,3,5-trifluoro-6-(trichloromethyl)phenyl]-2,3,6-trifluoro-5-(trichloromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 139812409 |
| Molecular Formula | C22Cl10F6N2O4 |
| Molecular Weight | 824.77 g/mol |
| Exact Mass | 819.66 |
| IUPAC Name | 3,4-dichloro-1-[4-[4-(3,4-dichloro-2,5-dioxopyrrol-1-yl)-2,3,5-trifluoro-6-(trichloromethyl)phenyl]-2,3,6-trifluoro-5-(trichloromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)N1c1c(F)c(F)c(-c2c(F)c(F)c(N3C(=O)C(Cl)=C(Cl)C3=O)c(F)c2C(Cl)(Cl)Cl)c(C(Cl)(Cl)Cl)c1F |
| InChI | InChI=1S/C22Cl10F6N2O4/c23-5-6(24)18(42)39(17(5)41)15-11(35)3(21(27,28)29)1(9(33)13(15)37)2-4(22(30,31)32)12(36)16(14(38)10(2)34)40-19(43)7(25)8(26)20(40)44 |
| InChIKey | MNORGIYFEMRLFV-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.77 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|