C14H5F4NO2 — CID 168516039
2-(2,3,5,6-tetrafluorophenyl)isoindole-1,3-dione (PubChem CID 168516039) has the molecular formula C14H5F4NO2 and a molecular weight of 295.19 g/mol. Its IUPAC name is 2-(2,3,5,6-tetrafluorophenyl)isoindole-1,3-dione.
| Compound Name | 2-(2,3,5,6-tetrafluorophenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168516039 |
| Molecular Formula | C14H5F4NO2 |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 2-(2,3,5,6-tetrafluorophenyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C14H5F4NO2/c15-8-5-9(16)11(18)12(10(8)17)19-13(20)6-3-1-2-4-7(6)14(19)21/h1-5H |
| InChIKey | MXFCHLXTIGTMBX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|