About 1-chloro-3,4-difluoro-2-(trichloromethyl)-5-(trifluoromethyl)benzene
1-chloro-3,4-difluoro-2-(trichloromethyl)-5-(trifluoromethyl)benzene (PubChem CID 44717491) has the molecular formula C8HCl4F5
and a molecular weight of 333.90 g/mol. Its IUPAC name is 1-chloro-3,4-difluoro-2-(trichloromethyl)-5-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-chloro-3,4-difluoro-2-(trichloromethyl)-5-(trifluoromethyl)benzene |
| PubChem CID | 44717491 |
| Molecular Formula | C8HCl4F5 |
| Molecular Weight | 333.90 g/mol |
| Exact Mass | 331.88 |
| IUPAC Name | 1-chloro-3,4-difluoro-2-(trichloromethyl)-5-(trifluoromethyl)benzene |
| SMILES | Fc1c(C(F)(F)F)cc(Cl)c(C(Cl)(Cl)Cl)c1F |
| InChI | InChI=1S/C8HCl4F5/c9-3-1-2(8(15,16)17)5(13)6(14)4(3)7(10,11)12/h1H |
| InChIKey | PEHVDMJTRUESJC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.90 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3,4-difluoro-2-(trichloromethyl)-5-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3,4-difluoro-2-(trichloromethyl)-5-(trifluoromethyl)benzene?
The IUPAC name of 1-chloro-3,4-difluoro-2-(trichloromethyl)-5-(trifluoromethyl)benzene (CID 44717491) is 1-chloro-3,4-difluoro-2-(trichloromethyl)-5-(trifluoromethyl)benzene.
What is the SMILES notation for 1-chloro-3,4-difluoro-2-(trichloromethyl)-5-(trifluoromethyl)benzene?
The canonical SMILES for 1-chloro-3,4-difluoro-2-(trichloromethyl)-5-(trifluoromethyl)benzene is Fc1c(C(F)(F)F)cc(Cl)c(C(Cl)(Cl)Cl)c1F.
What is the InChIKey of 1-chloro-3,4-difluoro-2-(trichloromethyl)-5-(trifluoromethyl)benzene?
The InChIKey is PEHVDMJTRUESJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8HCl4F5/c9-3-1-2(8(15,16)17)5(13)6(14)4(3)7(10,11)12/h1H.
What are the key properties of 1-chloro-3,4-difluoro-2-(trichloromethyl)-5-(trifluoromethyl)benzene?
1-chloro-3,4-difluoro-2-(trichloromethyl)-5-(trifluoromethyl)benzene has a molecular weight of 333.90 g/mol, XLogP of 5.46, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3,4-difluoro-2-(trichloromethyl)-5-(trifluoromethyl)benzene is sourced from PubChem (CID 44717491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).