C6F4IO- — CID 155760380
2,3,4,6-tetrafluoro-5-iodophenolate (PubChem CID 155760380) has the molecular formula C6F4IO- and a molecular weight of 290.96 g/mol. Its IUPAC name is 2,3,4,6-tetrafluoro-5-iodophenolate.
| Compound Name | 2,3,4,6-tetrafluoro-5-iodophenolate |
|---|---|
| PubChem CID | 155760380 |
| Molecular Formula | C6F4IO- |
| Molecular Weight | 290.96 g/mol |
| Exact Mass | 290.89 |
| IUPAC Name | 2,3,4,6-tetrafluoro-5-iodophenolate |
| SMILES | [O-]c1c(F)c(F)c(F)c(I)c1F |
| InChI | InChI=1S/C6HF4IO/c7-1-2(8)5(11)4(10)6(12)3(1)9/h12H/p-1 |
| InChIKey | BUSQUOVRECCGSG-UHFFFAOYSA-M |
| XLogP | 1.92 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.96 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|