About CID 101139091
CID 101139091 (PubChem CID 101139091) has the molecular formula C6F4I
and a molecular weight of 274.96 g/mol.
Molecular Properties
| Compound Name | CID 101139091 |
| PubChem CID | 101139091 |
| Molecular Formula | C6F4I |
| Molecular Weight | 274.96 g/mol |
| Exact Mass | 274.90 |
| IUPAC Name | — |
| SMILES | Fc1[c]c(F)c(F)c(I)c1F |
| InChI | InChI=1S/C6F4I/c7-2-1-3(8)5(10)6(11)4(2)9 |
| InChIKey | UPSVHVHUEKKXDV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.96 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 101139091 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101139091?
The IUPAC name of CID 101139091 (CID 101139091) is not available.
What is the SMILES notation for CID 101139091?
The canonical SMILES for CID 101139091 is Fc1[c]c(F)c(F)c(I)c1F.
What is the InChIKey of CID 101139091?
The InChIKey is UPSVHVHUEKKXDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6F4I/c7-2-1-3(8)5(10)6(11)4(2)9.
What are the key properties of CID 101139091?
CID 101139091 has a molecular weight of 274.96 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101139091 is sourced from PubChem (CID 101139091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).