C18H14F4I2N2 — CID 139178587
bis(4-methylpyridine);1,2,4,5-tetrafluoro-3,6-diiodobenzene (PubChem CID 139178587) has the molecular formula C18H14F4I2N2 and a molecular weight of 588.12 g/mol. Its IUPAC name is bis(4-methylpyridine);1,2,4,5-tetrafluoro-3,6-diiodobenzene.
| Compound Name | bis(4-methylpyridine);1,2,4,5-tetrafluoro-3,6-diiodobenzene |
|---|---|
| PubChem CID | 139178587 |
| Molecular Formula | C18H14F4I2N2 |
| Molecular Weight | 588.12 g/mol |
| Exact Mass | 587.92 |
| IUPAC Name | bis(4-methylpyridine);1,2,4,5-tetrafluoro-3,6-diiodobenzene |
| SMILES | Cc1ccncc1.Cc1ccncc1.Fc1c(F)c(I)c(F)c(F)c1I |
| InChI | InChI=1S/C6F4I2.2C6H7N/c7-1-2(8)6(12)4(10)3(9)5(1)11;2*1-6-2-4-7-5-3-6/h;2*2-5H,1H3 |
| InChIKey | SLVLJZCAEGSUCQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.12 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|