C13H6F4IN — CID 122210950
4-[(E)-2-(2,3,5,6-tetrafluoro-4-iodophenyl)ethenyl]pyridine (PubChem CID 122210950) has the molecular formula C13H6F4IN and a molecular weight of 379.09 g/mol. Its IUPAC name is 4-[(E)-2-(2,3,5,6-tetrafluoro-4-iodophenyl)ethenyl]pyridine.
| Compound Name | 4-[(E)-2-(2,3,5,6-tetrafluoro-4-iodophenyl)ethenyl]pyridine |
|---|---|
| PubChem CID | 122210950 |
| Molecular Formula | C13H6F4IN |
| Molecular Weight | 379.09 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | 4-[(E)-2-(2,3,5,6-tetrafluoro-4-iodophenyl)ethenyl]pyridine |
| SMILES | Fc1c(F)c(/C=C/c2ccncc2)c(F)c(F)c1I |
| InChI | InChI=1S/C13H6F4IN/c14-9-8(2-1-7-3-5-19-6-4-7)10(15)12(17)13(18)11(9)16/h1-6H/b2-1+ |
| InChIKey | CSKRIWHHRVNRNF-OWOJBTEDSA-N |
| XLogP | 4.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.09 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|