C18H10F12I2N2 — CID 139148027
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-diiodohexane;4-[(E)-2-pyridin-4-ylethenyl]pyridine (PubChem CID 139148027) has the molecular formula C18H10F12I2N2 and a molecular weight of 736.08 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-diiodohexane;4-[(E)-2-pyridin-4-ylethenyl]pyridine.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-diiodohexane;4-[(E)-2-pyridin-4-ylethenyl]pyridine |
|---|---|
| PubChem CID | 139148027 |
| Molecular Formula | C18H10F12I2N2 |
| Molecular Weight | 736.08 g/mol |
| Exact Mass | 735.87 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-diiodohexane;4-[(E)-2-pyridin-4-ylethenyl]pyridine |
| SMILES | C(=C/c1ccncc1)\c1ccncc1.FC(F)(I)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| InChI | InChI=1S/C12H10N2.C6F12I2/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;7-1(8,3(11,12)5(15,16)19)2(9,10)4(13,14)6(17,18)20/h1-10H;/b2-1+; |
| InChIKey | JGPMSOSORKCLNG-TYYBGVCCSA-N |
| XLogP | 8.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.08 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|