About 3,4-difluoro-2-iodoaniline;hydrochloride
3,4-difluoro-2-iodoaniline;hydrochloride (PubChem CID 165431084) has the molecular formula C6H5ClF2IN
and a molecular weight of 291.47 g/mol. Its IUPAC name is 3,4-difluoro-2-iodoaniline;hydrochloride.
Molecular Properties
| Compound Name | 3,4-difluoro-2-iodoaniline;hydrochloride |
| PubChem CID | 165431084 |
| Molecular Formula | C6H5ClF2IN |
| Molecular Weight | 291.47 g/mol |
| Exact Mass | 290.91 |
| IUPAC Name | 3,4-difluoro-2-iodoaniline;hydrochloride |
| SMILES | Cl.Nc1ccc(F)c(F)c1I |
| InChI | InChI=1S/C6H4F2IN.ClH/c7-3-1-2-4(10)6(9)5(3)8;/h1-2H,10H2;1H |
| InChIKey | KBVUSGKWBUDHLZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,4-difluoro-2-iodoaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-difluoro-2-iodoaniline;hydrochloride?
The IUPAC name of 3,4-difluoro-2-iodoaniline;hydrochloride (CID 165431084) is 3,4-difluoro-2-iodoaniline;hydrochloride.
What is the SMILES notation for 3,4-difluoro-2-iodoaniline;hydrochloride?
The canonical SMILES for 3,4-difluoro-2-iodoaniline;hydrochloride is Cl.Nc1ccc(F)c(F)c1I.
What is the InChIKey of 3,4-difluoro-2-iodoaniline;hydrochloride?
The InChIKey is KBVUSGKWBUDHLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F2IN.ClH/c7-3-1-2-4(10)6(9)5(3)8;/h1-2H,10H2;1H.
What are the key properties of 3,4-difluoro-2-iodoaniline;hydrochloride?
3,4-difluoro-2-iodoaniline;hydrochloride has a molecular weight of 291.47 g/mol, XLogP of 2.57, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-difluoro-2-iodoaniline;hydrochloride is sourced from PubChem (CID 165431084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).