About magnesium;1,2,4,5-tetrafluoro-3-iodobenzene;diiodide
magnesium;1,2,4,5-tetrafluoro-3-iodobenzene;diiodide (PubChem CID 175079415) has the molecular formula C6HF4I3Mg
and a molecular weight of 554.08 g/mol. Its IUPAC name is magnesium;1,2,4,5-tetrafluoro-3-iodobenzene;diiodide.
Molecular Properties
| Compound Name | magnesium;1,2,4,5-tetrafluoro-3-iodobenzene;diiodide |
| PubChem CID | 175079415 |
| Molecular Formula | C6HF4I3Mg |
| Molecular Weight | 554.08 g/mol |
| Exact Mass | 553.70 |
| IUPAC Name | magnesium;1,2,4,5-tetrafluoro-3-iodobenzene;diiodide |
| SMILES | Fc1cc(F)c(F)c(I)c1F.[I-].[I-].[Mg+2] |
| InChI | InChI=1S/C6HF4I.2HI.Mg/c7-2-1-3(8)5(10)6(11)4(2)9;;;/h1H;2*1H;/q;;;+2/p-2 |
| InChIKey | QRFAATKFUAUVPC-UHFFFAOYSA-L |
| XLogP | -3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 554.08 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze magnesium;1,2,4,5-tetrafluoro-3-iodobenzene;diiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1,2,4,5-tetrafluoro-3-iodobenzene;diiodide?
The IUPAC name of magnesium;1,2,4,5-tetrafluoro-3-iodobenzene;diiodide (CID 175079415) is magnesium;1,2,4,5-tetrafluoro-3-iodobenzene;diiodide.
What is the SMILES notation for magnesium;1,2,4,5-tetrafluoro-3-iodobenzene;diiodide?
The canonical SMILES for magnesium;1,2,4,5-tetrafluoro-3-iodobenzene;diiodide is Fc1cc(F)c(F)c(I)c1F.[I-].[I-].[Mg+2].
What is the InChIKey of magnesium;1,2,4,5-tetrafluoro-3-iodobenzene;diiodide?
The InChIKey is QRFAATKFUAUVPC-UHFFFAOYSA-L. The full InChI is InChI=1S/C6HF4I.2HI.Mg/c7-2-1-3(8)5(10)6(11)4(2)9;;;/h1H;2*1H;/q;;;+2/p-2.
What are the key properties of magnesium;1,2,4,5-tetrafluoro-3-iodobenzene;diiodide?
magnesium;1,2,4,5-tetrafluoro-3-iodobenzene;diiodide has a molecular weight of 554.08 g/mol, XLogP of -3.53, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1,2,4,5-tetrafluoro-3-iodobenzene;diiodide is sourced from PubChem (CID 175079415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).